C33H31ClF2N8O — CID 154046519
4-[[9-chloro-7-(2,6-difluorophenyl)-5H-pyrimido[5,4-c][2]benzazepin-2-yl]amino]-N-[4-(dimethylamino)piperidine-1-carboximidoyl]benzamide (PubChem CID 154046519) has the molecular formula C33H31ClF2N8O and a molecular weight of 629.12 g/mol. Its IUPAC name is 4-[[9-chloro-7-(2,6-difluorophenyl)-5H-pyrimido[5,4-c][2]benzazepin-2-yl]amino]-N-[4-(dimethylamino)piperidine-1-carboximidoyl]benzamide.
| Compound Name | 4-[[9-chloro-7-(2,6-difluorophenyl)-5H-pyrimido[5,4-c][2]benzazepin-2-yl]amino]-N-[4-(dimethylamino)piperidine-1-carboximidoyl]benzamide |
|---|---|
| PubChem CID | 154046519 |
| Molecular Formula | C33H31ClF2N8O |
| Molecular Weight | 629.12 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | 4-[[9-chloro-7-(2,6-difluorophenyl)-5H-pyrimido[5,4-c][2]benzazepin-2-yl]amino]-N-[4-(dimethylamino)piperidine-1-carboximidoyl]benzamide |
| SMILES | [H]/N=C(/NC(=O)c1ccc(Nc2ncc3c(n2)C=c2cc(Cl)cc(-c4c(F)cccc4F)c2=CN3)cc1)N1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C33H31ClF2N8O/c1-43(2)23-10-12-44(13-11-23)32(37)42-31(45)19-6-8-22(9-7-19)40-33-39-18-29-28(41-33)15-20-14-21(34)16-24(25(20)17-38-29)30-26(35)4-3-5-27(30)36/h3-9,14-18,23,38H,10-13H2,1-2H3,(H2,37,42,45)(H,39,40,41) |
| InChIKey | SJAWLRYBUHGSPA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 109.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.12 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|