C9H7NO2 — CID 154047392
1H-3,1-benzoxazepin-2-one (PubChem CID 154047392) has the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. Its IUPAC name is 1H-3,1-benzoxazepin-2-one.
| Compound Name | 1H-3,1-benzoxazepin-2-one |
|---|---|
| PubChem CID | 154047392 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 1H-3,1-benzoxazepin-2-one |
| SMILES | O=C1Nc2ccccc2C=CO1 |
| InChI | InChI=1S/C9H7NO2/c11-9-10-8-4-2-1-3-7(8)5-6-12-9/h1-6H,(H,10,11) |
| InChIKey | SQZVMLBWWDLIRT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |