C7H14F3NOSi — CID 154049838
N-[tert-butyl(methyl)silyl]-2,2,2-trifluoroacetamide (PubChem CID 154049838) has the molecular formula C7H14F3NOSi and a molecular weight of 213.27 g/mol. Its IUPAC name is N-[tert-butyl(methyl)silyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[tert-butyl(methyl)silyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 154049838 |
| Molecular Formula | C7H14F3NOSi |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | N-[tert-butyl(methyl)silyl]-2,2,2-trifluoroacetamide |
| SMILES | C[SiH](NC(=O)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C7H14F3NOSi/c1-6(2,3)13(4)11-5(12)7(8,9)10/h13H,1-4H3,(H,11,12) |
| InChIKey | MGZGZIGFZJDBMH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|