C29H23FN6O3 — CID 154054563
N-[3-[5-cyclopropyl-1-[(4-fluorophenyl)methylcarbamoyl]pyrazol-3-yl]-4-hydroxyphenyl]quinoxaline-2-carboxamide (PubChem CID 154054563) has the molecular formula C29H23FN6O3 and a molecular weight of 522.54 g/mol. Its IUPAC name is N-[3-[5-cyclopropyl-1-[(4-fluorophenyl)methylcarbamoyl]pyrazol-3-yl]-4-hydroxyphenyl]quinoxaline-2-carboxamide.
| Compound Name | N-[3-[5-cyclopropyl-1-[(4-fluorophenyl)methylcarbamoyl]pyrazol-3-yl]-4-hydroxyphenyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 154054563 |
| Molecular Formula | C29H23FN6O3 |
| Molecular Weight | 522.54 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | N-[3-[5-cyclopropyl-1-[(4-fluorophenyl)methylcarbamoyl]pyrazol-3-yl]-4-hydroxyphenyl]quinoxaline-2-carboxamide |
| SMILES | O=C(Nc1ccc(O)c(-c2cc(C3CC3)n(C(=O)NCc3ccc(F)cc3)n2)c1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C29H23FN6O3/c30-19-9-5-17(6-10-19)15-32-29(39)36-26(18-7-8-18)14-24(35-36)21-13-20(11-12-27(21)37)33-28(38)25-16-31-22-3-1-2-4-23(22)34-25/h1-6,9-14,16,18,37H,7-8,15H2,(H,32,39)(H,33,38) |
| InChIKey | SWBZKIHHIIQDSK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|