C23H23FN4O3 — CID 154054719
5-cyclopropyl-N-[(3-fluorophenyl)methyl]-3-[2-hydroxy-5-(propanoylamino)phenyl]pyrazole-1-carboxamide (PubChem CID 154054719) has the molecular formula C23H23FN4O3 and a molecular weight of 422.46 g/mol. Its IUPAC name is 5-cyclopropyl-N-[(3-fluorophenyl)methyl]-3-[2-hydroxy-5-(propanoylamino)phenyl]pyrazole-1-carboxamide.
| Compound Name | 5-cyclopropyl-N-[(3-fluorophenyl)methyl]-3-[2-hydroxy-5-(propanoylamino)phenyl]pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 154054719 |
| Molecular Formula | C23H23FN4O3 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 5-cyclopropyl-N-[(3-fluorophenyl)methyl]-3-[2-hydroxy-5-(propanoylamino)phenyl]pyrazole-1-carboxamide |
| SMILES | CCC(=O)Nc1ccc(O)c(-c2cc(C3CC3)n(C(=O)NCc3cccc(F)c3)n2)c1 |
| InChI | InChI=1S/C23H23FN4O3/c1-2-22(30)26-17-8-9-21(29)18(11-17)19-12-20(15-6-7-15)28(27-19)23(31)25-13-14-4-3-5-16(24)10-14/h3-5,8-12,15,29H,2,6-7,13H2,1H3,(H,25,31)(H,26,30) |
| InChIKey | QVELAXIZUZBJSE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|