About tert-butyl 5-amino-4-carbonochloridoyl-1,3-thiazole-2-carboxylate
tert-butyl 5-amino-4-carbonochloridoyl-1,3-thiazole-2-carboxylate (PubChem CID 154060147) has the molecular formula C9H11ClN2O3S
and a molecular weight of 262.72 g/mol. Its IUPAC name is tert-butyl 5-amino-4-carbonochloridoyl-1,3-thiazole-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 5-amino-4-carbonochloridoyl-1,3-thiazole-2-carboxylate |
| PubChem CID | 154060147 |
| Molecular Formula | C9H11ClN2O3S |
| Molecular Weight | 262.72 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | tert-butyl 5-amino-4-carbonochloridoyl-1,3-thiazole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1nc(C(=O)Cl)c(N)s1 |
| InChI | InChI=1S/C9H11ClN2O3S/c1-9(2,3)15-8(14)7-12-4(5(10)13)6(11)16-7/h11H2,1-3H3 |
| InChIKey | YYQHMIWUPMIVQW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.72 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 5-amino-4-carbonochloridoyl-1,3-thiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 5-amino-4-carbonochloridoyl-1,3-thiazole-2-carboxylate?
The IUPAC name of tert-butyl 5-amino-4-carbonochloridoyl-1,3-thiazole-2-carboxylate (CID 154060147) is tert-butyl 5-amino-4-carbonochloridoyl-1,3-thiazole-2-carboxylate.
What is the SMILES notation for tert-butyl 5-amino-4-carbonochloridoyl-1,3-thiazole-2-carboxylate?
The canonical SMILES for tert-butyl 5-amino-4-carbonochloridoyl-1,3-thiazole-2-carboxylate is CC(C)(C)OC(=O)c1nc(C(=O)Cl)c(N)s1.
What is the InChIKey of tert-butyl 5-amino-4-carbonochloridoyl-1,3-thiazole-2-carboxylate?
The InChIKey is YYQHMIWUPMIVQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClN2O3S/c1-9(2,3)15-8(14)7-12-4(5(10)13)6(11)16-7/h11H2,1-3H3.
What are the key properties of tert-butyl 5-amino-4-carbonochloridoyl-1,3-thiazole-2-carboxylate?
tert-butyl 5-amino-4-carbonochloridoyl-1,3-thiazole-2-carboxylate has a molecular weight of 262.72 g/mol, XLogP of 2.06, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5-amino-4-carbonochloridoyl-1,3-thiazole-2-carboxylate is sourced from PubChem (CID 154060147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).