C14H16N2O2S — CID 174671899
tert-butyl 4-amino-5-phenyl-1,3-thiazole-2-carboxylate (PubChem CID 174671899) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is tert-butyl 4-amino-5-phenyl-1,3-thiazole-2-carboxylate.
| Compound Name | tert-butyl 4-amino-5-phenyl-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 174671899 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | tert-butyl 4-amino-5-phenyl-1,3-thiazole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1nc(N)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C14H16N2O2S/c1-14(2,3)18-13(17)12-16-11(15)10(19-12)9-7-5-4-6-8-9/h4-8H,15H2,1-3H3 |
| InChIKey | LUBJTVPULBYWCZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |