C32H26F6N6O2S — CID 154062460
5-[[2-[4-[[[2-[2,4-bis(trifluoromethyl)phenyl]quinolin-3-yl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 154062460) has the molecular formula C32H26F6N6O2S and a molecular weight of 672.66 g/mol. Its IUPAC name is 5-[[2-[4-[[[2-[2,4-bis(trifluoromethyl)phenyl]quinolin-3-yl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[4-[[[2-[2,4-bis(trifluoromethyl)phenyl]quinolin-3-yl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 154062460 |
| Molecular Formula | C32H26F6N6O2S |
| Molecular Weight | 672.66 g/mol |
| Exact Mass | 672.17 |
| IUPAC Name | 5-[[2-[4-[[[2-[2,4-bis(trifluoromethyl)phenyl]quinolin-3-yl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccnc(N3CCC(CNCc4cc5ccccc5nc4-c4ccc(C(F)(F)F)cc4C(F)(F)F)CC3)n2)S1 |
| InChI | InChI=1S/C32H26F6N6O2S/c33-31(34,35)21-5-6-23(24(14-21)32(36,37)38)27-20(13-19-3-1-2-4-25(19)42-27)17-39-16-18-8-11-44(12-9-18)29-40-10-7-22(41-29)15-26-28(45)43-30(46)47-26/h1-7,10,13-15,18,39H,8-9,11-12,16-17H2,(H,43,45,46) |
| InChIKey | UANZFXVVTDYWOI-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.66 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|