C32H32N6O4S — CID 154062438
5-[[2-[4-[[[2-(2,4-dimethoxyphenyl)quinolin-3-yl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 154062438) has the molecular formula C32H32N6O4S and a molecular weight of 596.71 g/mol. Its IUPAC name is 5-[[2-[4-[[[2-(2,4-dimethoxyphenyl)quinolin-3-yl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[4-[[[2-(2,4-dimethoxyphenyl)quinolin-3-yl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 154062438 |
| Molecular Formula | C32H32N6O4S |
| Molecular Weight | 596.71 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | 5-[[2-[4-[[[2-(2,4-dimethoxyphenyl)quinolin-3-yl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(-c2nc3ccccc3cc2CNCC2CCN(c3nccc(C=C4SC(=O)NC4=O)n3)CC2)c(OC)c1 |
| InChI | InChI=1S/C32H32N6O4S/c1-41-24-7-8-25(27(17-24)42-2)29-22(15-21-5-3-4-6-26(21)36-29)19-33-18-20-10-13-38(14-11-20)31-34-12-9-23(35-31)16-28-30(39)37-32(40)43-28/h3-9,12,15-17,20,33H,10-11,13-14,18-19H2,1-2H3,(H,37,39,40) |
| InChIKey | ZJGPDQLOKFKNKP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.71 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|