C31H47N3O3 — CID 154066509
[(2R,3S)-3-amino-1-(3-methylbutylamino)-4-(4-methylphenyl)butan-2-yl] 3-(dipropylcarbamoyl)-5-methylbenzoate (PubChem CID 154066509) has the molecular formula C31H47N3O3 and a molecular weight of 509.74 g/mol. Its IUPAC name is [(2R,3S)-3-amino-1-(3-methylbutylamino)-4-(4-methylphenyl)butan-2-yl] 3-(dipropylcarbamoyl)-5-methylbenzoate.
| Compound Name | [(2R,3S)-3-amino-1-(3-methylbutylamino)-4-(4-methylphenyl)butan-2-yl] 3-(dipropylcarbamoyl)-5-methylbenzoate |
|---|---|
| PubChem CID | 154066509 |
| Molecular Formula | C31H47N3O3 |
| Molecular Weight | 509.74 g/mol |
| Exact Mass | 509.36 |
| IUPAC Name | [(2R,3S)-3-amino-1-(3-methylbutylamino)-4-(4-methylphenyl)butan-2-yl] 3-(dipropylcarbamoyl)-5-methylbenzoate |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)O[C@H](CNCCC(C)C)[C@@H](N)Cc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C31H47N3O3/c1-7-15-34(16-8-2)30(35)26-17-24(6)18-27(20-26)31(36)37-29(21-33-14-13-22(3)4)28(32)19-25-11-9-23(5)10-12-25/h9-12,17-18,20,22,28-29,33H,7-8,13-16,19,21,32H2,1-6H3/t28-,29+/m0/s1 |
| InChIKey | JZFWIFBJZPYBTI-URLMMPGGSA-N |
| XLogP | 5.30 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.74 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|