C31H45N3O5 — CID 69495807
[(2R,3S)-3-amino-4-(1,3-benzodioxol-5-yl)-1-(3-methylbutylamino)butan-2-yl] 3-(dipropylcarbamoyl)-5-methylbenzoate (PubChem CID 69495807) has the molecular formula C31H45N3O5 and a molecular weight of 539.72 g/mol. Its IUPAC name is [(2R,3S)-3-amino-4-(1,3-benzodioxol-5-yl)-1-(3-methylbutylamino)butan-2-yl] 3-(dipropylcarbamoyl)-5-methylbenzoate.
| Compound Name | [(2R,3S)-3-amino-4-(1,3-benzodioxol-5-yl)-1-(3-methylbutylamino)butan-2-yl] 3-(dipropylcarbamoyl)-5-methylbenzoate |
|---|---|
| PubChem CID | 69495807 |
| Molecular Formula | C31H45N3O5 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.34 |
| IUPAC Name | [(2R,3S)-3-amino-4-(1,3-benzodioxol-5-yl)-1-(3-methylbutylamino)butan-2-yl] 3-(dipropylcarbamoyl)-5-methylbenzoate |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)O[C@H](CNCCC(C)C)[C@@H](N)Cc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C31H45N3O5/c1-6-12-34(13-7-2)30(35)24-14-22(5)15-25(18-24)31(36)39-29(19-33-11-10-21(3)4)26(32)16-23-8-9-27-28(17-23)38-20-37-27/h8-9,14-15,17-18,21,26,29,33H,6-7,10-13,16,19-20,32H2,1-5H3/t26-,29+/m0/s1 |
| InChIKey | JGAFYOLMCOGVTB-LITSAYRRSA-N |
| XLogP | 4.72 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|