C16H18ClF3N8 — CID 154067761
8-[5-[(6-chloropyrazin-2-yl)amino]pentyl]-N-methyl-2-(trifluoromethyl)pyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 154067761) has the molecular formula C16H18ClF3N8 and a molecular weight of 414.82 g/mol. Its IUPAC name is 8-[5-[(6-chloropyrazin-2-yl)amino]pentyl]-N-methyl-2-(trifluoromethyl)pyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | 8-[5-[(6-chloropyrazin-2-yl)amino]pentyl]-N-methyl-2-(trifluoromethyl)pyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 154067761 |
| Molecular Formula | C16H18ClF3N8 |
| Molecular Weight | 414.82 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 8-[5-[(6-chloropyrazin-2-yl)amino]pentyl]-N-methyl-2-(trifluoromethyl)pyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | CNc1nc(C(F)(F)F)nc2c(CCCCCNc3cncc(Cl)n3)cnn12 |
| InChI | InChI=1S/C16H18ClF3N8/c1-21-15-27-14(16(18,19)20)26-13-10(7-24-28(13)15)5-3-2-4-6-23-12-9-22-8-11(17)25-12/h7-9H,2-6H2,1H3,(H,23,25)(H,21,26,27) |
| InChIKey | KMIHZCGOBXIFGR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 92.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.82 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|