C68H80N4 — CID 154069250
5,10,15,20-tetrakis(2,3,4-triethylphenyl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 154069250) has the molecular formula C68H80N4 and a molecular weight of 953.42 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(2,3,4-triethylphenyl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(2,3,4-triethylphenyl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 154069250 |
| Molecular Formula | C68H80N4 |
| Molecular Weight | 953.42 g/mol |
| Exact Mass | 952.64 |
| IUPAC Name | 5,10,15,20-tetrakis(2,3,4-triethylphenyl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | CCc1ccc(C2=c3ccc([nH]3)=C(c3ccc(CC)c(CC)c3CC)c3ccc([nH]3)C(c3ccc(CC)c(CC)c3CC)=c3ccc([nH]3)=C(c3ccc(CC)c(CC)c3CC)c3ccc2[nH]3)c(CC)c1CC |
| InChI | InChI=1S/C68H80N4/c1-13-41-25-29-53(49(21-9)45(41)17-5)65-57-33-35-59(69-57)66(54-30-26-42(14-2)46(18-6)50(54)22-10)61-37-39-63(71-61)68(56-32-28-44(16-4)48(20-8)52(56)24-12)64-40-38-62(72-64)67(60-36-34-58(65)70-60)55-31-27-43(15-3)47(19-7)51(55)23-11/h25-40,69-72H,13-24H2,1-12H3 |
| InChIKey | FKBQHGUFDBJMIH-UHFFFAOYSA-N |
| XLogP | 13.05 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.42 |
| LogP ≤ 5 | 13.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |