C13H15F2N2O4- — CID 154072008
4-[4-amino-2-(difluoromethoxy)phenoxy]piperidine-1-carboxylate (PubChem CID 154072008) has the molecular formula C13H15F2N2O4- and a molecular weight of 301.27 g/mol. Its IUPAC name is 4-[4-amino-2-(difluoromethoxy)phenoxy]piperidine-1-carboxylate.
| Compound Name | 4-[4-amino-2-(difluoromethoxy)phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 154072008 |
| Molecular Formula | C13H15F2N2O4- |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 4-[4-amino-2-(difluoromethoxy)phenoxy]piperidine-1-carboxylate |
| SMILES | Nc1ccc(OC2CCN(C(=O)[O-])CC2)c(OC(F)F)c1 |
| InChI | InChI=1S/C13H16F2N2O4/c14-12(15)21-11-7-8(16)1-2-10(11)20-9-3-5-17(6-4-9)13(18)19/h1-2,7,9,12H,3-6,16H2,(H,18,19)/p-1 |
| InChIKey | POWNTSKIZITNIC-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|