C13H16ClF3N2O2 — CID 119373762
(4-aminopiperidin-1-yl)-[2-(difluoromethoxy)-4-fluorophenyl]methanone;hydrochloride (PubChem CID 119373762) has the molecular formula C13H16ClF3N2O2 and a molecular weight of 324.73 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-[2-(difluoromethoxy)-4-fluorophenyl]methanone;hydrochloride.
| Compound Name | (4-aminopiperidin-1-yl)-[2-(difluoromethoxy)-4-fluorophenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119373762 |
| Molecular Formula | C13H16ClF3N2O2 |
| Molecular Weight | 324.73 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | (4-aminopiperidin-1-yl)-[2-(difluoromethoxy)-4-fluorophenyl]methanone;hydrochloride |
| SMILES | Cl.NC1CCN(C(=O)c2ccc(F)cc2OC(F)F)CC1 |
| InChI | InChI=1S/C13H15F3N2O2.ClH/c14-8-1-2-10(11(7-8)20-13(15)16)12(19)18-5-3-9(17)4-6-18;/h1-2,7,9,13H,3-6,17H2;1H |
| InChIKey | YOGAIIXPQJTJJW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.73 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |