C21H22F3NO4 — CID 154072762
[5-(4-methoxyphenyl)-2-methyl-3-oxo-1-[4-(trifluoromethyl)phenyl]pentyl]carbamic acid (PubChem CID 154072762) has the molecular formula C21H22F3NO4 and a molecular weight of 409.40 g/mol. Its IUPAC name is [5-(4-methoxyphenyl)-2-methyl-3-oxo-1-[4-(trifluoromethyl)phenyl]pentyl]carbamic acid.
| Compound Name | [5-(4-methoxyphenyl)-2-methyl-3-oxo-1-[4-(trifluoromethyl)phenyl]pentyl]carbamic acid |
|---|---|
| PubChem CID | 154072762 |
| Molecular Formula | C21H22F3NO4 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | [5-(4-methoxyphenyl)-2-methyl-3-oxo-1-[4-(trifluoromethyl)phenyl]pentyl]carbamic acid |
| SMILES | COc1ccc(CCC(=O)C(C)C(NC(=O)O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H22F3NO4/c1-13(18(26)12-5-14-3-10-17(29-2)11-4-14)19(25-20(27)28)15-6-8-16(9-7-15)21(22,23)24/h3-4,6-11,13,19,25H,5,12H2,1-2H3,(H,27,28) |
| InChIKey | LYCVGGNZBCKZOL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |