C19H27BrO — CID 154073445
(8S,9S,10R,13R,14S)-3-bromo-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one (PubChem CID 154073445) has the molecular formula C19H27BrO and a molecular weight of 351.33 g/mol. Its IUPAC name is (8S,9S,10R,13R,14S)-3-bromo-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one.
| Compound Name | (8S,9S,10R,13R,14S)-3-bromo-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one |
|---|---|
| PubChem CID | 154073445 |
| Molecular Formula | C19H27BrO |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (8S,9S,10R,13R,14S)-3-bromo-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4CC(Br)CC[C@@]43C)[C@@H]1CC(=O)C2 |
| InChI | InChI=1S/C19H27BrO/c1-18-7-6-16-15(17(18)10-14(21)11-18)4-3-12-9-13(20)5-8-19(12,16)2/h3,13,15-17H,4-11H2,1-2H3/t13?,15-,16+,17+,18-,19+/m1/s1 |
| InChIKey | CMWWRNHTVCSRPK-DPKMYYEESA-N |
| XLogP | 5.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|