C19H20F3N2O4- — CID 154079185
N-[3-hydroxy-1-phenyl-4-[[2-(trifluoromethoxy)phenyl]methylamino]butan-2-yl]carbamate (PubChem CID 154079185) has the molecular formula C19H20F3N2O4- and a molecular weight of 397.37 g/mol. Its IUPAC name is N-[3-hydroxy-1-phenyl-4-[[2-(trifluoromethoxy)phenyl]methylamino]butan-2-yl]carbamate.
| Compound Name | N-[3-hydroxy-1-phenyl-4-[[2-(trifluoromethoxy)phenyl]methylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 154079185 |
| Molecular Formula | C19H20F3N2O4- |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-[3-hydroxy-1-phenyl-4-[[2-(trifluoromethoxy)phenyl]methylamino]butan-2-yl]carbamate |
| SMILES | O=C([O-])NC(Cc1ccccc1)C(O)CNCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C19H21F3N2O4/c20-19(21,22)28-17-9-5-4-8-14(17)11-23-12-16(25)15(24-18(26)27)10-13-6-2-1-3-7-13/h1-9,15-16,23-25H,10-12H2,(H,26,27)/p-1 |
| InChIKey | PYDMIRQCELSLSW-UHFFFAOYSA-M |
| XLogP | 1.58 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |