C23H44O4 — CID 154085055
(3-hydroxy-2,2-dimethylpropyl) (12R)-12-hydroxyoctadec-9-enoate (PubChem CID 154085055) has the molecular formula C23H44O4 and a molecular weight of 384.60 g/mol. Its IUPAC name is (3-hydroxy-2,2-dimethylpropyl) (12R)-12-hydroxyoctadec-9-enoate.
| Compound Name | (3-hydroxy-2,2-dimethylpropyl) (12R)-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 154085055 |
| Molecular Formula | C23H44O4 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.32 |
| IUPAC Name | (3-hydroxy-2,2-dimethylpropyl) (12R)-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OCC(C)(C)CO |
| InChI | InChI=1S/C23H44O4/c1-4-5-6-13-16-21(25)17-14-11-9-7-8-10-12-15-18-22(26)27-20-23(2,3)19-24/h11,14,21,24-25H,4-10,12-13,15-20H2,1-3H3/t21-/m1/s1 |
| InChIKey | FKRLEYXKAWWVGL-OAQYLSRUSA-N |
| XLogP | 5.56 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|