C18H30O2 — CID 154089898
1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]decan-1-one (PubChem CID 154089898) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]decan-1-one.
| Compound Name | 1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]decan-1-one |
|---|---|
| PubChem CID | 154089898 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 1-[1-(methoxymethyl)cyclohexa-2,5-dien-1-yl]decan-1-one |
| SMILES | CCCCCCCCCC(=O)C1(COC)C=CCC=C1 |
| InChI | InChI=1S/C18H30O2/c1-3-4-5-6-7-8-10-13-17(19)18(16-20-2)14-11-9-12-15-18/h11-12,14-15H,3-10,13,16H2,1-2H3 |
| InChIKey | IUBUKFPCICNNTA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|