C18H32O2 — CID 22966989
(2E)-7-methoxy-4,4,6,8-tetramethyltrideca-2,12-dien-5-one (PubChem CID 22966989) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is (2E)-7-methoxy-4,4,6,8-tetramethyltrideca-2,12-dien-5-one.
| Compound Name | (2E)-7-methoxy-4,4,6,8-tetramethyltrideca-2,12-dien-5-one |
|---|---|
| PubChem CID | 22966989 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | (2E)-7-methoxy-4,4,6,8-tetramethyltrideca-2,12-dien-5-one |
| SMILES | C=CCCCC(C)C(OC)C(C)C(=O)C(C)(C)/C=C/C |
| InChI | InChI=1S/C18H32O2/c1-8-10-11-12-14(3)16(20-7)15(4)17(19)18(5,6)13-9-2/h8-9,13-16H,1,10-12H2,2-7H3/b13-9+ |
| InChIKey | SODVOUGYHUPUHE-UKTHLTGXSA-N |
| XLogP | 4.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|