About O-[3-dimethylsilyl-3-(3-ethoxypropoxy)propyl] octanethioate
O-[3-dimethylsilyl-3-(3-ethoxypropoxy)propyl] octanethioate (PubChem CID 154100619) has the molecular formula C18H38O3SSi
and a molecular weight of 362.65 g/mol. Its IUPAC name is O-[3-dimethylsilyl-3-(3-ethoxypropoxy)propyl] octanethioate.
Molecular Properties
| Compound Name | O-[3-dimethylsilyl-3-(3-ethoxypropoxy)propyl] octanethioate |
| PubChem CID | 154100619 |
| Molecular Formula | C18H38O3SSi |
| Molecular Weight | 362.65 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | O-[3-dimethylsilyl-3-(3-ethoxypropoxy)propyl] octanethioate |
| SMILES | CCCCCCCC(=S)OCCC(OCCCOCC)[SiH](C)C |
| InChI | InChI=1S/C18H38O3SSi/c1-5-7-8-9-10-12-17(22)20-16-13-18(23(3)4)21-15-11-14-19-6-2/h18,23H,5-16H2,1-4H3 |
| InChIKey | HLDAGAHJDVCZQG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.65 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[3-dimethylsilyl-3-(3-ethoxypropoxy)propyl] octanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[3-dimethylsilyl-3-(3-ethoxypropoxy)propyl] octanethioate?
The IUPAC name of O-[3-dimethylsilyl-3-(3-ethoxypropoxy)propyl] octanethioate (CID 154100619) is O-[3-dimethylsilyl-3-(3-ethoxypropoxy)propyl] octanethioate.
What is the SMILES notation for O-[3-dimethylsilyl-3-(3-ethoxypropoxy)propyl] octanethioate?
The canonical SMILES for O-[3-dimethylsilyl-3-(3-ethoxypropoxy)propyl] octanethioate is CCCCCCCC(=S)OCCC(OCCCOCC)[SiH](C)C.
What is the InChIKey of O-[3-dimethylsilyl-3-(3-ethoxypropoxy)propyl] octanethioate?
The InChIKey is HLDAGAHJDVCZQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O3SSi/c1-5-7-8-9-10-12-17(22)20-16-13-18(23(3)4)21-15-11-14-19-6-2/h18,23H,5-16H2,1-4H3.
What are the key properties of O-[3-dimethylsilyl-3-(3-ethoxypropoxy)propyl] octanethioate?
O-[3-dimethylsilyl-3-(3-ethoxypropoxy)propyl] octanethioate has a molecular weight of 362.65 g/mol, XLogP of 4.92, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-[3-dimethylsilyl-3-(3-ethoxypropoxy)propyl] octanethioate is sourced from PubChem (CID 154100619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).