C11H15N3 — CID 154101946
(4,4-dimethyl-3H-quinolin-2-yl)hydrazine (PubChem CID 154101946) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is (4,4-dimethyl-3H-quinolin-2-yl)hydrazine.
| Compound Name | (4,4-dimethyl-3H-quinolin-2-yl)hydrazine |
|---|---|
| PubChem CID | 154101946 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | (4,4-dimethyl-3H-quinolin-2-yl)hydrazine |
| SMILES | CC1(C)CC(NN)=Nc2ccccc21 |
| InChI | InChI=1S/C11H15N3/c1-11(2)7-10(14-12)13-9-6-4-3-5-8(9)11/h3-6H,7,12H2,1-2H3,(H,13,14) |
| InChIKey | HRZUDIPJTXNSSR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|