C11H9NOS — CID 125489436
(8bS)-8b-methyl-1H-thieno[2,3-b]indol-2-one (PubChem CID 125489436) has the molecular formula C11H9NOS and a molecular weight of 203.27 g/mol. Its IUPAC name is (8bS)-8b-methyl-1H-thieno[2,3-b]indol-2-one.
| Compound Name | (8bS)-8b-methyl-1H-thieno[2,3-b]indol-2-one |
|---|---|
| PubChem CID | 125489436 |
| Molecular Formula | C11H9NOS |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | (8bS)-8b-methyl-1H-thieno[2,3-b]indol-2-one |
| SMILES | C[C@@]12CC(=O)SC1=Nc1ccccc12 |
| InChI | InChI=1S/C11H9NOS/c1-11-6-9(13)14-10(11)12-8-5-3-2-4-7(8)11/h2-5H,6H2,1H3/t11-/m0/s1 |
| InChIKey | NKQQGNJFRWXZGI-NSHDSACASA-N |
| XLogP | 2.65 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|