C13H13NO2 — CID 139068970
(E)-2-(3,3-dimethylindol-2-yl)-3-hydroxyprop-2-enal (PubChem CID 139068970) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is (E)-2-(3,3-dimethylindol-2-yl)-3-hydroxyprop-2-enal.
| Compound Name | (E)-2-(3,3-dimethylindol-2-yl)-3-hydroxyprop-2-enal |
|---|---|
| PubChem CID | 139068970 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | (E)-2-(3,3-dimethylindol-2-yl)-3-hydroxyprop-2-enal |
| SMILES | CC1(C)C(/C(C=O)=C\O)=Nc2ccccc21 |
| InChI | InChI=1S/C13H13NO2/c1-13(2)10-5-3-4-6-11(10)14-12(13)9(7-15)8-16/h3-8,15H,1-2H3/b9-7- |
| InChIKey | UOHPWQMHYQSXED-CLFYSBASSA-N |
| XLogP | 2.69 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|