C16H14N2O2 — CID 135870726
(Z)-2-(3,3-dimethylpyrrolo[3,2-h]quinolin-2-yl)-3-hydroxyprop-2-enal (PubChem CID 135870726) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is (Z)-2-(3,3-dimethylpyrrolo[3,2-h]quinolin-2-yl)-3-hydroxyprop-2-enal.
| Compound Name | (Z)-2-(3,3-dimethylpyrrolo[3,2-h]quinolin-2-yl)-3-hydroxyprop-2-enal |
|---|---|
| PubChem CID | 135870726 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (Z)-2-(3,3-dimethylpyrrolo[3,2-h]quinolin-2-yl)-3-hydroxyprop-2-enal |
| SMILES | CC1(C)C(/C(C=O)=C/O)=Nc2c1ccc1cccnc21 |
| InChI | InChI=1S/C16H14N2O2/c1-16(2)12-6-5-10-4-3-7-17-13(10)14(12)18-15(16)11(8-19)9-20/h3-9,19H,1-2H3/b11-8+ |
| InChIKey | DZRRRXKNFMMQGC-DHZHZOJOSA-N |
| XLogP | 3.24 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|