C11H24N2S — CID 154102492
1-butyl-1,3-di(propan-2-yl)thiourea (PubChem CID 154102492) has the molecular formula C11H24N2S and a molecular weight of 216.39 g/mol. Its IUPAC name is 1-butyl-1,3-di(propan-2-yl)thiourea.
| Compound Name | 1-butyl-1,3-di(propan-2-yl)thiourea |
|---|---|
| PubChem CID | 154102492 |
| Molecular Formula | C11H24N2S |
| Molecular Weight | 216.39 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 1-butyl-1,3-di(propan-2-yl)thiourea |
| SMILES | CCCCN(C(=S)NC(C)C)C(C)C |
| InChI | InChI=1S/C11H24N2S/c1-6-7-8-13(10(4)5)11(14)12-9(2)3/h9-10H,6-8H2,1-5H3,(H,12,14) |
| InChIKey | KRZWXYGBHDCRFM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|