C14H20F3NO4 — CID 15410313
(2R)-1,1,1-trifluoro-4-[4-[[(2R)-2-hydroxy-3-methoxypropyl]amino]phenoxy]butan-2-ol (PubChem CID 15410313) has the molecular formula C14H20F3NO4 and a molecular weight of 323.31 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-4-[4-[[(2R)-2-hydroxy-3-methoxypropyl]amino]phenoxy]butan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-4-[4-[[(2R)-2-hydroxy-3-methoxypropyl]amino]phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 15410313 |
| Molecular Formula | C14H20F3NO4 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (2R)-1,1,1-trifluoro-4-[4-[[(2R)-2-hydroxy-3-methoxypropyl]amino]phenoxy]butan-2-ol |
| SMILES | COC[C@H](O)CNc1ccc(OCC[C@@H](O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H20F3NO4/c1-21-9-11(19)8-18-10-2-4-12(5-3-10)22-7-6-13(20)14(15,16)17/h2-5,11,13,18-20H,6-9H2,1H3/t11-,13-/m1/s1 |
| InChIKey | KVZDVFASGYGASR-DGCLKSJQSA-N |
| XLogP | 1.80 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|