C9H13AsO5 — CID 154103287
[4-(1-hydroxypropoxy)phenyl]arsonic acid (PubChem CID 154103287) has the molecular formula C9H13AsO5 and a molecular weight of 276.12 g/mol. Its IUPAC name is [4-(1-hydroxypropoxy)phenyl]arsonic acid.
| Compound Name | [4-(1-hydroxypropoxy)phenyl]arsonic acid |
|---|---|
| PubChem CID | 154103287 |
| Molecular Formula | C9H13AsO5 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | [4-(1-hydroxypropoxy)phenyl]arsonic acid |
| SMILES | CCC(O)Oc1ccc([As](=O)(O)O)cc1 |
| InChI | InChI=1S/C9H13AsO5/c1-2-9(11)15-8-5-3-7(4-6-8)10(12,13)14/h3-6,9,11H,2H2,1H3,(H2,12,13,14) |
| InChIKey | ZZNNLRGRPLRYBG-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|