C10H14O4 — CID 19593615
1-(4-methoxyphenoxy)propane-1,3-diol (PubChem CID 19593615) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is 1-(4-methoxyphenoxy)propane-1,3-diol.
| Compound Name | 1-(4-methoxyphenoxy)propane-1,3-diol |
|---|---|
| PubChem CID | 19593615 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1-(4-methoxyphenoxy)propane-1,3-diol |
| SMILES | COc1ccc(OC(O)CCO)cc1 |
| InChI | InChI=1S/C10H14O4/c1-13-8-2-4-9(5-3-8)14-10(12)6-7-11/h2-5,10-12H,6-7H2,1H3 |
| InChIKey | BXEMIUVGJSZMBH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|