C37H50N2O5Si — CID 154108114
tert-butyl (2S)-4-[(2S)-1-tert-butylsilyloxy-1,1-diphenyl-4-phenylmethoxybutan-2-yl]-2-methyl-3-oxopiperazine-1-carboxylate (PubChem CID 154108114) has the molecular formula C37H50N2O5Si and a molecular weight of 630.90 g/mol. Its IUPAC name is tert-butyl (2S)-4-[(2S)-1-tert-butylsilyloxy-1,1-diphenyl-4-phenylmethoxybutan-2-yl]-2-methyl-3-oxopiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-[(2S)-1-tert-butylsilyloxy-1,1-diphenyl-4-phenylmethoxybutan-2-yl]-2-methyl-3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 154108114 |
| Molecular Formula | C37H50N2O5Si |
| Molecular Weight | 630.90 g/mol |
| Exact Mass | 630.35 |
| IUPAC Name | tert-butyl (2S)-4-[(2S)-1-tert-butylsilyloxy-1,1-diphenyl-4-phenylmethoxybutan-2-yl]-2-methyl-3-oxopiperazine-1-carboxylate |
| SMILES | C[C@H]1C(=O)N([C@@H](CCOCc2ccccc2)C(O[SiH2]C(C)(C)C)(c2ccccc2)c2ccccc2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H50N2O5Si/c1-28-33(40)39(25-24-38(28)34(41)43-35(2,3)4)32(23-26-42-27-29-17-11-8-12-18-29)37(44-45-36(5,6)7,30-19-13-9-14-20-30)31-21-15-10-16-22-31/h8-22,28,32H,23-27,45H2,1-7H3/t28-,32-/m0/s1 |
| InChIKey | DBVHJZSQJPJFQP-IUDBTDONSA-N |
| XLogP | 6.69 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.90 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|