C27H35NO2Si — CID 154137263
(2S)-1-tert-butylsilyloxy-1,1-diphenyl-4-phenylmethoxybutan-2-amine (PubChem CID 154137263) has the molecular formula C27H35NO2Si and a molecular weight of 433.67 g/mol. Its IUPAC name is (2S)-1-tert-butylsilyloxy-1,1-diphenyl-4-phenylmethoxybutan-2-amine.
| Compound Name | (2S)-1-tert-butylsilyloxy-1,1-diphenyl-4-phenylmethoxybutan-2-amine |
|---|---|
| PubChem CID | 154137263 |
| Molecular Formula | C27H35NO2Si |
| Molecular Weight | 433.67 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | (2S)-1-tert-butylsilyloxy-1,1-diphenyl-4-phenylmethoxybutan-2-amine |
| SMILES | CC(C)(C)[SiH2]OC(c1ccccc1)(c1ccccc1)[C@@H](N)CCOCc1ccccc1 |
| InChI | InChI=1S/C27H35NO2Si/c1-26(2,3)31-30-27(23-15-9-5-10-16-23,24-17-11-6-12-18-24)25(28)19-20-29-21-22-13-7-4-8-14-22/h4-18,25H,19-21,28,31H2,1-3H3/t25-/m0/s1 |
| InChIKey | RFHDMYVGYIMBDG-VWLOTQADSA-N |
| XLogP | 5.18 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.67 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|