C39H56N2O7Si — CID 154114528
tert-butyl N-[(2S)-1-[[(2S)-1-tert-butylsilyloxy-1,1-diphenyl-4-phenylmethoxybutan-2-yl]-(2,2-dimethoxyethyl)amino]-1-oxopropan-2-yl]carbamate (PubChem CID 154114528) has the molecular formula C39H56N2O7Si and a molecular weight of 692.97 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(2S)-1-tert-butylsilyloxy-1,1-diphenyl-4-phenylmethoxybutan-2-yl]-(2,2-dimethoxyethyl)amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(2S)-1-tert-butylsilyloxy-1,1-diphenyl-4-phenylmethoxybutan-2-yl]-(2,2-dimethoxyethyl)amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 154114528 |
| Molecular Formula | C39H56N2O7Si |
| Molecular Weight | 692.97 g/mol |
| Exact Mass | 692.39 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(2S)-1-tert-butylsilyloxy-1,1-diphenyl-4-phenylmethoxybutan-2-yl]-(2,2-dimethoxyethyl)amino]-1-oxopropan-2-yl]carbamate |
| SMILES | COC(CN(C(=O)[C@H](C)NC(=O)OC(C)(C)C)[C@@H](CCOCc1ccccc1)C(O[SiH2]C(C)(C)C)(c1ccccc1)c1ccccc1)OC |
| InChI | InChI=1S/C39H56N2O7Si/c1-29(40-36(43)47-37(2,3)4)35(42)41(27-34(44-8)45-9)33(25-26-46-28-30-19-13-10-14-20-30)39(48-49-38(5,6)7,31-21-15-11-16-22-31)32-23-17-12-18-24-32/h10-24,29,33-34H,25-28,49H2,1-9H3,(H,40,43)/t29-,33-/m0/s1 |
| InChIKey | ATLVXTMGBYGJGE-ZQAZVOLISA-N |
| XLogP | 6.59 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.97 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|