C12H12Cl5NS — CID 154112453
1-[(2,3,4,5,6-pentachlorophenyl)sulfanylmethyl]piperidine (PubChem CID 154112453) has the molecular formula C12H12Cl5NS and a molecular weight of 379.57 g/mol. Its IUPAC name is 1-[(2,3,4,5,6-pentachlorophenyl)sulfanylmethyl]piperidine.
| Compound Name | 1-[(2,3,4,5,6-pentachlorophenyl)sulfanylmethyl]piperidine |
|---|---|
| PubChem CID | 154112453 |
| Molecular Formula | C12H12Cl5NS |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 376.91 |
| IUPAC Name | 1-[(2,3,4,5,6-pentachlorophenyl)sulfanylmethyl]piperidine |
| SMILES | Clc1c(Cl)c(Cl)c(SCN2CCCCC2)c(Cl)c1Cl |
| InChI | InChI=1S/C12H12Cl5NS/c13-7-8(14)10(16)12(11(17)9(7)15)19-6-18-4-2-1-3-5-18/h1-6H2 |
| InChIKey | REUFBQRKMVAROP-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|