About (4-propylphenyl)methyl nitrite
(4-propylphenyl)methyl nitrite (PubChem CID 154112943) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is (4-propylphenyl)methyl nitrite.
Molecular Properties
| Compound Name | (4-propylphenyl)methyl nitrite |
| PubChem CID | 154112943 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (4-propylphenyl)methyl nitrite |
| SMILES | CCCc1ccc(CON=O)cc1 |
| InChI | InChI=1S/C10H13NO2/c1-2-3-9-4-6-10(7-5-9)8-13-11-12/h4-7H,2-3,8H2,1H3 |
| InChIKey | WGCLUVZLLAOWFS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-propylphenyl)methyl nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-propylphenyl)methyl nitrite?
The IUPAC name of (4-propylphenyl)methyl nitrite (CID 154112943) is (4-propylphenyl)methyl nitrite.
What is the SMILES notation for (4-propylphenyl)methyl nitrite?
The canonical SMILES for (4-propylphenyl)methyl nitrite is CCCc1ccc(CON=O)cc1.
What is the InChIKey of (4-propylphenyl)methyl nitrite?
The InChIKey is WGCLUVZLLAOWFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-2-3-9-4-6-10(7-5-9)8-13-11-12/h4-7H,2-3,8H2,1H3.
What are the key properties of (4-propylphenyl)methyl nitrite?
(4-propylphenyl)methyl nitrite has a molecular weight of 179.22 g/mol, XLogP of 2.84, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-propylphenyl)methyl nitrite is sourced from PubChem (CID 154112943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).