C19H16N2O4 — CID 154115522
2,6-bis(3-aminophenoxy)benzoic acid (PubChem CID 154115522) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 2,6-bis(3-aminophenoxy)benzoic acid.
| Compound Name | 2,6-bis(3-aminophenoxy)benzoic acid |
|---|---|
| PubChem CID | 154115522 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2,6-bis(3-aminophenoxy)benzoic acid |
| SMILES | Nc1cccc(Oc2cccc(Oc3cccc(N)c3)c2C(=O)O)c1 |
| InChI | InChI=1S/C19H16N2O4/c20-12-4-1-6-14(10-12)24-16-8-3-9-17(18(16)19(22)23)25-15-7-2-5-13(21)11-15/h1-11H,20-21H2,(H,22,23) |
| InChIKey | HIMDPSAAXQPUMG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|