C15H12F3NO5 — CID 162305453
3-(3-aminophenoxy)benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 162305453) has the molecular formula C15H12F3NO5 and a molecular weight of 343.26 g/mol. Its IUPAC name is 3-(3-aminophenoxy)benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(3-aminophenoxy)benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162305453 |
| Molecular Formula | C15H12F3NO5 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 3-(3-aminophenoxy)benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | Nc1cccc(Oc2cccc(C(=O)O)c2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H11NO3.C2HF3O2/c14-10-4-2-6-12(8-10)17-11-5-1-3-9(7-11)13(15)16;3-2(4,5)1(6)7/h1-8H,14H2,(H,15,16);(H,6,7) |
| InChIKey | GNRSOVWHIWZOJO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|