C40H46F4O10 — CID 154115678
4-(4-decanoyloxyphenoxy)carbonyloxy-2-[4-[(2R)-7-ethoxy-1,1,1-trifluoroheptan-2-yl]oxycarbonyl-3-fluorophenyl]benzoic acid (PubChem CID 154115678) has the molecular formula C40H46F4O10 and a molecular weight of 762.79 g/mol. Its IUPAC name is 4-(4-decanoyloxyphenoxy)carbonyloxy-2-[4-[(2R)-7-ethoxy-1,1,1-trifluoroheptan-2-yl]oxycarbonyl-3-fluorophenyl]benzoic acid.
| Compound Name | 4-(4-decanoyloxyphenoxy)carbonyloxy-2-[4-[(2R)-7-ethoxy-1,1,1-trifluoroheptan-2-yl]oxycarbonyl-3-fluorophenyl]benzoic acid |
|---|---|
| PubChem CID | 154115678 |
| Molecular Formula | C40H46F4O10 |
| Molecular Weight | 762.79 g/mol |
| Exact Mass | 762.30 |
| IUPAC Name | 4-(4-decanoyloxyphenoxy)carbonyloxy-2-[4-[(2R)-7-ethoxy-1,1,1-trifluoroheptan-2-yl]oxycarbonyl-3-fluorophenyl]benzoic acid |
| SMILES | CCCCCCCCCC(=O)Oc1ccc(OC(=O)Oc2ccc(C(=O)O)c(-c3ccc(C(=O)O[C@H](CCCCCOCC)C(F)(F)F)c(F)c3)c2)cc1 |
| InChI | InChI=1S/C40H46F4O10/c1-3-5-6-7-8-9-12-15-36(45)51-28-17-19-29(20-18-28)52-39(49)53-30-21-23-31(37(46)47)33(26-30)27-16-22-32(34(41)25-27)38(48)54-35(40(42,43)44)14-11-10-13-24-50-4-2/h16-23,25-26,35H,3-15,24H2,1-2H3,(H,46,47)/t35-/m1/s1 |
| InChIKey | AVUYGCDYXYSFTJ-PGUFJCEWSA-N |
| XLogP | 10.50 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.79 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|