C11H15N3 — CID 154116078
1-(4-diazocyclohexa-1,5-dien-1-yl)piperidine (PubChem CID 154116078) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-(4-diazocyclohexa-1,5-dien-1-yl)piperidine.
| Compound Name | 1-(4-diazocyclohexa-1,5-dien-1-yl)piperidine |
|---|---|
| PubChem CID | 154116078 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 1-(4-diazocyclohexa-1,5-dien-1-yl)piperidine |
| SMILES | [N-]=[N+]=C1C=CC(N2CCCCC2)=CC1 |
| InChI | InChI=1S/C11H15N3/c12-13-10-4-6-11(7-5-10)14-8-2-1-3-9-14/h4,6-7H,1-3,5,8-9H2 |
| InChIKey | IROQTHLQEVFWRS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 39.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|