C18H28N4O2 — CID 154116224
2-[(2-cyclohexyl-5-methylpyrazol-3-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid (PubChem CID 154116224) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 2-[(2-cyclohexyl-5-methylpyrazol-3-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid.
| Compound Name | 2-[(2-cyclohexyl-5-methylpyrazol-3-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 154116224 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 2-[(2-cyclohexyl-5-methylpyrazol-3-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid |
| SMILES | Cc1cc(CN2CC3CN(C(=O)O)CC3C2)n(C2CCCCC2)n1 |
| InChI | InChI=1S/C18H28N4O2/c1-13-7-17(22(19-13)16-5-3-2-4-6-16)12-20-8-14-10-21(18(23)24)11-15(14)9-20/h7,14-16H,2-6,8-12H2,1H3,(H,23,24) |
| InChIKey | VEEQBJCABDUTOX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |