About benzylsulfanyloxybenzene
benzylsulfanyloxybenzene (PubChem CID 154119819) has the molecular formula C13H12OS
and a molecular weight of 216.31 g/mol. Its IUPAC name is benzylsulfanyloxybenzene.
Molecular Properties
| Compound Name | benzylsulfanyloxybenzene |
| PubChem CID | 154119819 |
| Molecular Formula | C13H12OS |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | benzylsulfanyloxybenzene |
| SMILES | c1ccc(CSOc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12OS/c1-3-7-12(8-4-1)11-15-14-13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | BQQHTMUFPWRPNA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzylsulfanyloxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylsulfanyloxybenzene?
The IUPAC name of benzylsulfanyloxybenzene (CID 154119819) is benzylsulfanyloxybenzene.
What is the SMILES notation for benzylsulfanyloxybenzene?
The canonical SMILES for benzylsulfanyloxybenzene is c1ccc(CSOc2ccccc2)cc1.
What is the InChIKey of benzylsulfanyloxybenzene?
The InChIKey is BQQHTMUFPWRPNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12OS/c1-3-7-12(8-4-1)11-15-14-13-9-5-2-6-10-13/h1-10H,11H2.
What are the key properties of benzylsulfanyloxybenzene?
benzylsulfanyloxybenzene has a molecular weight of 216.31 g/mol, XLogP of 3.91, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzylsulfanyloxybenzene is sourced from PubChem (CID 154119819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).