C24H33N5O — CID 154120007
1-[3,5-bis[4-(diethylamino)phenyl]-1,2,4-triazol-4-yl]ethanol (PubChem CID 154120007) has the molecular formula C24H33N5O and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-[3,5-bis[4-(diethylamino)phenyl]-1,2,4-triazol-4-yl]ethanol.
| Compound Name | 1-[3,5-bis[4-(diethylamino)phenyl]-1,2,4-triazol-4-yl]ethanol |
|---|---|
| PubChem CID | 154120007 |
| Molecular Formula | C24H33N5O |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | 1-[3,5-bis[4-(diethylamino)phenyl]-1,2,4-triazol-4-yl]ethanol |
| SMILES | CCN(CC)c1ccc(-c2nnc(-c3ccc(N(CC)CC)cc3)n2C(C)O)cc1 |
| InChI | InChI=1S/C24H33N5O/c1-6-27(7-2)21-14-10-19(11-15-21)23-25-26-24(29(23)18(5)30)20-12-16-22(17-13-20)28(8-3)9-4/h10-18,30H,6-9H2,1-5H3 |
| InChIKey | ALJVFDIHBBRASK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |