C19H22F2O2 — CID 154123495
5-[2-(2,6-difluorophenyl)ethyl]-1,3-dimethoxy-2-propylbenzene (PubChem CID 154123495) has the molecular formula C19H22F2O2 and a molecular weight of 320.38 g/mol. Its IUPAC name is 5-[2-(2,6-difluorophenyl)ethyl]-1,3-dimethoxy-2-propylbenzene.
| Compound Name | 5-[2-(2,6-difluorophenyl)ethyl]-1,3-dimethoxy-2-propylbenzene |
|---|---|
| PubChem CID | 154123495 |
| Molecular Formula | C19H22F2O2 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 5-[2-(2,6-difluorophenyl)ethyl]-1,3-dimethoxy-2-propylbenzene |
| SMILES | CCCc1c(OC)cc(CCc2c(F)cccc2F)cc1OC |
| InChI | InChI=1S/C19H22F2O2/c1-4-6-15-18(22-2)11-13(12-19(15)23-3)9-10-14-16(20)7-5-8-17(14)21/h5,7-8,11-12H,4,6,9-10H2,1-3H3 |
| InChIKey | YLCXYOCQQRXAAY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |