C16H14O5 — CID 154123600
2-benzyl-2,6-dihydroxy-4-methoxy-1-benzofuran-3-one (PubChem CID 154123600) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is 2-benzyl-2,6-dihydroxy-4-methoxy-1-benzofuran-3-one.
| Compound Name | 2-benzyl-2,6-dihydroxy-4-methoxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 154123600 |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-benzyl-2,6-dihydroxy-4-methoxy-1-benzofuran-3-one |
| SMILES | COc1cc(O)cc2c1C(=O)C(O)(Cc1ccccc1)O2 |
| InChI | InChI=1S/C16H14O5/c1-20-12-7-11(17)8-13-14(12)15(18)16(19,21-13)9-10-5-3-2-4-6-10/h2-8,17,19H,9H2,1H3 |
| InChIKey | VTWBWSBDQVHVRR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |