C31H34O9P+ — CID 129152613
benzyl-(2,6-dimethoxy-4-oxocyclohexa-2,5-dien-1-yl)-bis(4-hydroxy-2,6-dimethoxyphenyl)phosphanium (PubChem CID 129152613) has the molecular formula C31H34O9P+ and a molecular weight of 581.58 g/mol. Its IUPAC name is benzyl-(2,6-dimethoxy-4-oxocyclohexa-2,5-dien-1-yl)-bis(4-hydroxy-2,6-dimethoxyphenyl)phosphanium.
| Compound Name | benzyl-(2,6-dimethoxy-4-oxocyclohexa-2,5-dien-1-yl)-bis(4-hydroxy-2,6-dimethoxyphenyl)phosphanium |
|---|---|
| PubChem CID | 129152613 |
| Molecular Formula | C31H34O9P+ |
| Molecular Weight | 581.58 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | benzyl-(2,6-dimethoxy-4-oxocyclohexa-2,5-dien-1-yl)-bis(4-hydroxy-2,6-dimethoxyphenyl)phosphanium |
| SMILES | COC1=CC(=O)C=C(OC)C1[P+](Cc1ccccc1)(c1c(OC)cc(O)cc1OC)c1c(OC)cc(O)cc1OC |
| InChI | InChI=1S/C31H33O9P/c1-35-23-12-20(32)13-24(36-2)29(23)41(18-19-10-8-7-9-11-19,30-25(37-3)14-21(33)15-26(30)38-4)31-27(39-5)16-22(34)17-28(31)40-6/h7-17,29H,18H2,1-6H3,(H-,33,34)/p+1 |
| InChIKey | YBDONLMHWYRELD-UHFFFAOYSA-O |
| XLogP | 4.31 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|