C14H13NO — CID 154123924
1-phenyl-2,3-dihydroisoindol-1-ol (PubChem CID 154123924) has the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. Its IUPAC name is 1-phenyl-2,3-dihydroisoindol-1-ol.
| Compound Name | 1-phenyl-2,3-dihydroisoindol-1-ol |
|---|---|
| PubChem CID | 154123924 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 1-phenyl-2,3-dihydroisoindol-1-ol |
| SMILES | OC1(c2ccccc2)NCc2ccccc21 |
| InChI | InChI=1S/C14H13NO/c16-14(12-7-2-1-3-8-12)13-9-5-4-6-11(13)10-15-14/h1-9,15-16H,10H2 |
| InChIKey | FCNQYAULBIZXEM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |