C14H13NO2S — CID 89243056
4-(1-sulfanyl-2,3-dihydroisoindol-1-yl)benzene-1,2-diol (PubChem CID 89243056) has the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. Its IUPAC name is 4-(1-sulfanyl-2,3-dihydroisoindol-1-yl)benzene-1,2-diol.
| Compound Name | 4-(1-sulfanyl-2,3-dihydroisoindol-1-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 89243056 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 4-(1-sulfanyl-2,3-dihydroisoindol-1-yl)benzene-1,2-diol |
| SMILES | Oc1ccc(C2(S)NCc3ccccc32)cc1O |
| InChI | InChI=1S/C14H13NO2S/c16-12-6-5-10(7-13(12)17)14(18)11-4-2-1-3-9(11)8-15-14/h1-7,15-18H,8H2 |
| InChIKey | LTAOOEPDUYREGQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|