C11H20N2S — CID 154124942
4-octyl-1,3-dihydroimidazole-2-thione (PubChem CID 154124942) has the molecular formula C11H20N2S and a molecular weight of 212.36 g/mol. Its IUPAC name is 4-octyl-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-octyl-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 154124942 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 4-octyl-1,3-dihydroimidazole-2-thione |
| SMILES | CCCCCCCCc1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C11H20N2S/c1-2-3-4-5-6-7-8-10-9-12-11(14)13-10/h9H,2-8H2,1H3,(H2,12,13,14) |
| InChIKey | NABOSGQNAFOJBC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|