C24H26N2O2 — CID 154125888
(4aS,12aR)-4a-(3-hydroxyphenyl)-2,7-dimethyl-3,4,5,12-tetrahydro-1H-pyrido[3,4-b]acridin-12a-ol (PubChem CID 154125888) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is (4aS,12aR)-4a-(3-hydroxyphenyl)-2,7-dimethyl-3,4,5,12-tetrahydro-1H-pyrido[3,4-b]acridin-12a-ol.
| Compound Name | (4aS,12aR)-4a-(3-hydroxyphenyl)-2,7-dimethyl-3,4,5,12-tetrahydro-1H-pyrido[3,4-b]acridin-12a-ol |
|---|---|
| PubChem CID | 154125888 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | (4aS,12aR)-4a-(3-hydroxyphenyl)-2,7-dimethyl-3,4,5,12-tetrahydro-1H-pyrido[3,4-b]acridin-12a-ol |
| SMILES | Cc1cccc2cc3c(nc12)C[C@]1(c2cccc(O)c2)CCN(C)C[C@@]1(O)C3 |
| InChI | InChI=1S/C24H26N2O2/c1-16-5-3-6-17-11-18-13-24(28)15-26(2)10-9-23(24,14-21(18)25-22(16)17)19-7-4-8-20(27)12-19/h3-8,11-12,27-28H,9-10,13-15H2,1-2H3/t23-,24-/m0/s1 |
| InChIKey | DIDRIZUGSYBKLU-ZEQRLZLVSA-N |
| XLogP | 3.35 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |