About 3-[(3S)-1,3-dimethylazepan-3-yl]phenol
3-[(3S)-1,3-dimethylazepan-3-yl]phenol (PubChem CID 143979159) has the molecular formula C14H21NO
and a molecular weight of 219.33 g/mol. Its IUPAC name is 3-[(3S)-1,3-dimethylazepan-3-yl]phenol.
Molecular Properties
| Compound Name | 3-[(3S)-1,3-dimethylazepan-3-yl]phenol |
| PubChem CID | 143979159 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 3-[(3S)-1,3-dimethylazepan-3-yl]phenol |
| SMILES | CN1CCCC[C@@](C)(c2cccc(O)c2)C1 |
| InChI | InChI=1S/C14H21NO/c1-14(8-3-4-9-15(2)11-14)12-6-5-7-13(16)10-12/h5-7,10,16H,3-4,8-9,11H2,1-2H3/t14-/m1/s1 |
| InChIKey | LBJMODGXTMCLCY-CQSZACIVSA-N |
| XLogP | 2.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(3S)-1,3-dimethylazepan-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3S)-1,3-dimethylazepan-3-yl]phenol?
The IUPAC name of 3-[(3S)-1,3-dimethylazepan-3-yl]phenol (CID 143979159) is 3-[(3S)-1,3-dimethylazepan-3-yl]phenol.
What is the SMILES notation for 3-[(3S)-1,3-dimethylazepan-3-yl]phenol?
The canonical SMILES for 3-[(3S)-1,3-dimethylazepan-3-yl]phenol is CN1CCCC[C@@](C)(c2cccc(O)c2)C1.
What is the InChIKey of 3-[(3S)-1,3-dimethylazepan-3-yl]phenol?
The InChIKey is LBJMODGXTMCLCY-CQSZACIVSA-N. The full InChI is InChI=1S/C14H21NO/c1-14(8-3-4-9-15(2)11-14)12-6-5-7-13(16)10-12/h5-7,10,16H,3-4,8-9,11H2,1-2H3/t14-/m1/s1.
What are the key properties of 3-[(3S)-1,3-dimethylazepan-3-yl]phenol?
3-[(3S)-1,3-dimethylazepan-3-yl]phenol has a molecular weight of 219.33 g/mol, XLogP of 2.77, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3S)-1,3-dimethylazepan-3-yl]phenol is sourced from PubChem (CID 143979159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).